About naphthalen-2-ol;nitrobenzene
naphthalen-2-ol;nitrobenzene (PubChem CID 163774452) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is naphthalen-2-ol;nitrobenzene.
Molecular Properties
| Compound Name | naphthalen-2-ol;nitrobenzene |
| PubChem CID | 163774452 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | naphthalen-2-ol;nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C6H5NO2/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-7(9)6-4-2-1-3-5-6/h1-7,11H;1-5H |
| InChIKey | MJEXVFUCBPKOSN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ol;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ol;nitrobenzene?
The IUPAC name of naphthalen-2-ol;nitrobenzene (CID 163774452) is naphthalen-2-ol;nitrobenzene.
What is the SMILES notation for naphthalen-2-ol;nitrobenzene?
The canonical SMILES for naphthalen-2-ol;nitrobenzene is O=[N+]([O-])c1ccccc1.Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ol;nitrobenzene?
The InChIKey is MJEXVFUCBPKOSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H5NO2/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-7(9)6-4-2-1-3-5-6/h1-7,11H;1-5H.
What are the key properties of naphthalen-2-ol;nitrobenzene?
naphthalen-2-ol;nitrobenzene has a molecular weight of 267.28 g/mol, XLogP of 4.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ol;nitrobenzene is sourced from PubChem (CID 163774452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).