About naphthalen-2-ol;4-nitroaniline
naphthalen-2-ol;4-nitroaniline (PubChem CID 160761253) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is naphthalen-2-ol;4-nitroaniline.
Molecular Properties
| Compound Name | naphthalen-2-ol;4-nitroaniline |
| PubChem CID | 160761253 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | naphthalen-2-ol;4-nitroaniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C6H6N2O2/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-1-3-6(4-2-5)8(9)10/h1-7,11H;1-4H,7H2 |
| InChIKey | RYCFIQUZTPJGBX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ol;4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ol;4-nitroaniline?
The IUPAC name of naphthalen-2-ol;4-nitroaniline (CID 160761253) is naphthalen-2-ol;4-nitroaniline.
What is the SMILES notation for naphthalen-2-ol;4-nitroaniline?
The canonical SMILES for naphthalen-2-ol;4-nitroaniline is Nc1ccc([N+](=O)[O-])cc1.Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ol;4-nitroaniline?
The InChIKey is RYCFIQUZTPJGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H6N2O2/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-1-3-6(4-2-5)8(9)10/h1-7,11H;1-4H,7H2.
What are the key properties of naphthalen-2-ol;4-nitroaniline?
naphthalen-2-ol;4-nitroaniline has a molecular weight of 282.30 g/mol, XLogP of 3.72, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ol;4-nitroaniline is sourced from PubChem (CID 160761253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).