About 2-amino-5-nitrophenol;naphthalen-2-ol
2-amino-5-nitrophenol;naphthalen-2-ol (PubChem CID 23314581) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-amino-5-nitrophenol;naphthalen-2-ol.
Molecular Properties
| Compound Name | 2-amino-5-nitrophenol;naphthalen-2-ol |
| PubChem CID | 23314581 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-amino-5-nitrophenol;naphthalen-2-ol |
| SMILES | Nc1ccc([N+](=O)[O-])cc1O.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C6H6N2O3/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-2-1-4(8(10)11)3-6(5)9/h1-7,11H;1-3,9H,7H2 |
| InChIKey | CQJKNZBUBWIGHQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-nitrophenol;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-nitrophenol;naphthalen-2-ol?
The IUPAC name of 2-amino-5-nitrophenol;naphthalen-2-ol (CID 23314581) is 2-amino-5-nitrophenol;naphthalen-2-ol.
What is the SMILES notation for 2-amino-5-nitrophenol;naphthalen-2-ol?
The canonical SMILES for 2-amino-5-nitrophenol;naphthalen-2-ol is Nc1ccc([N+](=O)[O-])cc1O.Oc1ccc2ccccc2c1.
What is the InChIKey of 2-amino-5-nitrophenol;naphthalen-2-ol?
The InChIKey is CQJKNZBUBWIGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H6N2O3/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-2-1-4(8(10)11)3-6(5)9/h1-7,11H;1-3,9H,7H2.
What are the key properties of 2-amino-5-nitrophenol;naphthalen-2-ol?
2-amino-5-nitrophenol;naphthalen-2-ol has a molecular weight of 298.30 g/mol, XLogP of 3.43, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-nitrophenol;naphthalen-2-ol is sourced from PubChem (CID 23314581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).