About 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate
3-nitroaniline;(3-nitrophenyl)azanium;perchlorate (PubChem CID 139070143) has the molecular formula C12H13ClN4O8
and a molecular weight of 376.71 g/mol. Its IUPAC name is 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate.
Molecular Properties
| Compound Name | 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate |
| PubChem CID | 139070143 |
| Molecular Formula | C12H13ClN4O8 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate |
| SMILES | Nc1cccc([N+](=O)[O-])c1.[NH3+]c1cccc([N+](=O)[O-])c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/2C6H6N2O2.ClHO4/c2*7-5-2-1-3-6(4-5)8(9)10;2-1(3,4)5/h2*1-4H,7H2;(H,2,3,4,5) |
| InChIKey | BBOZCSPZOCRBFZ-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 232.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate?
The IUPAC name of 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate (CID 139070143) is 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate.
What is the SMILES notation for 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate?
The canonical SMILES for 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate is Nc1cccc([N+](=O)[O-])c1.[NH3+]c1cccc([N+](=O)[O-])c1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate?
The InChIKey is BBOZCSPZOCRBFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6N2O2.ClHO4/c2*7-5-2-1-3-6(4-5)8(9)10;2-1(3,4)5/h2*1-4H,7H2;(H,2,3,4,5).
What are the key properties of 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate?
3-nitroaniline;(3-nitrophenyl)azanium;perchlorate has a molecular weight of 376.71 g/mol, XLogP of -3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroaniline;(3-nitrophenyl)azanium;perchlorate is sourced from PubChem (CID 139070143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).