About 3-nitrobenzenediazonium
3-nitrobenzenediazonium (PubChem CID 10883106) has the molecular formula C6H4N3O2+
and a molecular weight of 150.12 g/mol. Its IUPAC name is 3-nitrobenzenediazonium.
Molecular Properties
| Compound Name | 3-nitrobenzenediazonium |
| PubChem CID | 10883106 |
| Molecular Formula | C6H4N3O2+ |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 3-nitrobenzenediazonium |
| SMILES | N#[N+]c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N3O2/c7-8-5-2-1-3-6(4-5)9(10)11/h1-4H/q+1 |
| InChIKey | PTZGBPAXEKEBSB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzenediazonium?
The IUPAC name of 3-nitrobenzenediazonium (CID 10883106) is 3-nitrobenzenediazonium.
What is the SMILES notation for 3-nitrobenzenediazonium?
The canonical SMILES for 3-nitrobenzenediazonium is N#[N+]c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzenediazonium?
The InChIKey is PTZGBPAXEKEBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3O2/c7-8-5-2-1-3-6(4-5)9(10)11/h1-4H/q+1.
What are the key properties of 3-nitrobenzenediazonium?
3-nitrobenzenediazonium has a molecular weight of 150.12 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzenediazonium is sourced from PubChem (CID 10883106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).