About 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile
2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile (PubChem CID 158393114) has the molecular formula C16H14N4O2
and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile |
| PubChem CID | 158393114 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile |
| SMILES | N#CCc1cccc(N)c1.N#CCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6N2O2.C8H8N2/c9-5-4-7-2-1-3-8(6-7)10(11)12;9-5-4-7-2-1-3-8(10)6-7/h1-3,6H,4H2;1-3,6H,4,10H2 |
| InChIKey | GXFGPAXHYBZERC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile?
The IUPAC name of 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile (CID 158393114) is 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile.
What is the SMILES notation for 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile?
The canonical SMILES for 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile is N#CCc1cccc(N)c1.N#CCc1cccc([N+](=O)[O-])c1.
What is the InChIKey of 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile?
The InChIKey is GXFGPAXHYBZERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C8H8N2/c9-5-4-7-2-1-3-8(6-7)10(11)12;9-5-4-7-2-1-3-8(10)6-7/h1-3,6H,4H2;1-3,6H,4,10H2.
What are the key properties of 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile?
2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile has a molecular weight of 294.31 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)acetonitrile;2-(3-nitrophenyl)acetonitrile is sourced from PubChem (CID 158393114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).