About 8-nitrotetracen-2-amine
8-nitrotetracen-2-amine (PubChem CID 101022943) has the molecular formula C18H12N2O2
and a molecular weight of 288.31 g/mol. Its IUPAC name is 8-nitrotetracen-2-amine.
Molecular Properties
| Compound Name | 8-nitrotetracen-2-amine |
| PubChem CID | 101022943 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 8-nitrotetracen-2-amine |
| SMILES | Nc1ccc2cc3cc4cc([N+](=O)[O-])ccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12N2O2/c19-17-3-1-11-5-14-8-16-10-18(20(21)22)4-2-12(16)6-13(14)7-15(11)9-17/h1-10H,19H2 |
| InChIKey | WEHNUOZJOJCMNC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-nitrotetracen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitrotetracen-2-amine?
The IUPAC name of 8-nitrotetracen-2-amine (CID 101022943) is 8-nitrotetracen-2-amine.
What is the SMILES notation for 8-nitrotetracen-2-amine?
The canonical SMILES for 8-nitrotetracen-2-amine is Nc1ccc2cc3cc4cc([N+](=O)[O-])ccc4cc3cc2c1.
What is the InChIKey of 8-nitrotetracen-2-amine?
The InChIKey is WEHNUOZJOJCMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2/c19-17-3-1-11-5-14-8-16-10-18(20(21)22)4-2-12(16)6-13(14)7-15(11)9-17/h1-10H,19H2.
What are the key properties of 8-nitrotetracen-2-amine?
8-nitrotetracen-2-amine has a molecular weight of 288.31 g/mol, XLogP of 4.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitrotetracen-2-amine is sourced from PubChem (CID 101022943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).