C25H16N4O4 — CID 102316953
7,7'-dinitro-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 102316953) has the molecular formula C25H16N4O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 7,7'-dinitro-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 7,7'-dinitro-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 102316953 |
| Molecular Formula | C25H16N4O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 7,7'-dinitro-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | Nc1ccc2c(c1)C1(c3cc(N)ccc3-c3ccc([N+](=O)[O-])cc31)c1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C25H16N4O4/c26-13-1-5-17-19-7-3-15(28(30)31)11-23(19)25(21(17)9-13)22-10-14(27)2-6-18(22)20-8-4-16(29(32)33)12-24(20)25/h1-12H,26-27H2 |
| InChIKey | VZGUBUUYXKWRJL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|