C49H32N4O4 — CID 101481750
7,7'-dinitro-2-N,2-N,2-N',2-N'-tetraphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 101481750) has the molecular formula C49H32N4O4 and a molecular weight of 740.82 g/mol. Its IUPAC name is 7,7'-dinitro-2-N,2-N,2-N',2-N'-tetraphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 7,7'-dinitro-2-N,2-N,2-N',2-N'-tetraphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 101481750 |
| Molecular Formula | C49H32N4O4 |
| Molecular Weight | 740.82 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | 7,7'-dinitro-2-N,2-N,2-N',2-N'-tetraphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1(c3cc(N(c4ccccc4)c4ccccc4)ccc3-2)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C49H32N4O4/c54-52(55)39-23-27-43-41-25-21-37(50(33-13-5-1-6-14-33)34-15-7-2-8-16-34)29-45(41)49(47(43)31-39)46-30-38(22-26-42(46)44-28-24-40(53(56)57)32-48(44)49)51(35-17-9-3-10-18-35)36-19-11-4-12-20-36/h1-32H |
| InChIKey | MMAFCXWHTRUOBV-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.82 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|