C61H42N4O4 — CID 130251893
4-[9,9-bis(4-nitrophenyl)-7-[4-(N-phenylanilino)phenyl]fluoren-2-yl]-N,N-diphenylaniline (PubChem CID 130251893) has the molecular formula C61H42N4O4 and a molecular weight of 895.03 g/mol. Its IUPAC name is 4-[9,9-bis(4-nitrophenyl)-7-[4-(N-phenylanilino)phenyl]fluoren-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[9,9-bis(4-nitrophenyl)-7-[4-(N-phenylanilino)phenyl]fluoren-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 130251893 |
| Molecular Formula | C61H42N4O4 |
| Molecular Weight | 895.03 g/mol |
| Exact Mass | 894.32 |
| IUPAC Name | 4-[9,9-bis(4-nitrophenyl)-7-[4-(N-phenylanilino)phenyl]fluoren-2-yl]-N,N-diphenylaniline |
| SMILES | O=[N+]([O-])c1ccc(C2(c3ccc([N+](=O)[O-])cc3)c3cc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc3-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc32)cc1 |
| InChI | InChI=1S/C61H42N4O4/c66-64(67)55-35-27-47(28-36-55)61(48-29-37-56(38-30-48)65(68)69)59-41-45(43-21-31-53(32-22-43)62(49-13-5-1-6-14-49)50-15-7-2-8-16-50)25-39-57(59)58-40-26-46(42-60(58)61)44-23-33-54(34-24-44)63(51-17-9-3-10-18-51)52-19-11-4-12-20-52/h1-42H |
| InChIKey | IQQKLDUOACMTHC-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.03 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|