C18H20N2O2 — CID 175049936
4-(1,3,3-trimethyl-5-nitro-2H-inden-1-yl)aniline (PubChem CID 175049936) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(1,3,3-trimethyl-5-nitro-2H-inden-1-yl)aniline.
| Compound Name | 4-(1,3,3-trimethyl-5-nitro-2H-inden-1-yl)aniline |
|---|---|
| PubChem CID | 175049936 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(1,3,3-trimethyl-5-nitro-2H-inden-1-yl)aniline |
| SMILES | CC1(C)CC(C)(c2ccc(N)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H20N2O2/c1-17(2)11-18(3,12-4-6-13(19)7-5-12)15-9-8-14(20(21)22)10-16(15)17/h4-10H,11,19H2,1-3H3 |
| InChIKey | QNHBHXUIZZOXME-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|