C12H15IN2O2 — CID 15529752
2,4,4-trimethyl-7-nitro-3H-isoquinolin-2-ium iodide (PubChem CID 15529752) has the molecular formula C12H15IN2O2 and a molecular weight of 346.17 g/mol. Its IUPAC name is 2,4,4-trimethyl-7-nitro-3H-isoquinolin-2-ium iodide.
| Compound Name | 2,4,4-trimethyl-7-nitro-3H-isoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 15529752 |
| Molecular Formula | C12H15IN2O2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2,4,4-trimethyl-7-nitro-3H-isoquinolin-2-ium iodide |
| SMILES | C[N+]1=Cc2cc([N+](=O)[O-])ccc2C(C)(C)C1.[I-] |
| InChI | InChI=1S/C12H15N2O2.HI/c1-12(2)8-13(3)7-9-6-10(14(15)16)4-5-11(9)12;/h4-7H,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WARAPPOATAAIBQ-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|