C11H12N2O2 — CID 20553389
2,3,3-trimethyl-6-nitroindole (PubChem CID 20553389) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2,3,3-trimethyl-6-nitroindole.
| Compound Name | 2,3,3-trimethyl-6-nitroindole |
|---|---|
| PubChem CID | 20553389 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2,3,3-trimethyl-6-nitroindole |
| SMILES | CC1=Nc2cc([N+](=O)[O-])ccc2C1(C)C |
| InChI | InChI=1S/C11H12N2O2/c1-7-11(2,3)9-5-4-8(13(14)15)6-10(9)12-7/h4-6H,1-3H3 |
| InChIKey | WEJDAPZSRQPETI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|