C12H15N2O2+ — CID 32641137
1,2,3,3-tetramethyl-6-nitroindol-1-ium (PubChem CID 32641137) has the molecular formula C12H15N2O2+ and a molecular weight of 219.26 g/mol. Its IUPAC name is 1,2,3,3-tetramethyl-6-nitroindol-1-ium.
| Compound Name | 1,2,3,3-tetramethyl-6-nitroindol-1-ium |
|---|---|
| PubChem CID | 32641137 |
| Molecular Formula | C12H15N2O2+ |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1,2,3,3-tetramethyl-6-nitroindol-1-ium |
| SMILES | CC1=[N+](C)c2cc([N+](=O)[O-])ccc2C1(C)C |
| InChI | InChI=1S/C12H15N2O2/c1-8-12(2,3)10-6-5-9(14(15)16)7-11(10)13(8)4/h5-7H,1-4H3/q+1 |
| InChIKey | ICTQBBPHBDUKQK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|