C7H8N2O4 — CID 87329382
N,N-dihydroxy-2-methyl-5-nitroaniline (PubChem CID 87329382) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is N,N-dihydroxy-2-methyl-5-nitroaniline.
| Compound Name | N,N-dihydroxy-2-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 87329382 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N,N-dihydroxy-2-methyl-5-nitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(O)O |
| InChI | InChI=1S/C7H8N2O4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,12-13H,1H3 |
| InChIKey | NKBBQZXIYSBERG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|