About 2-methyl-4-nitrophenol;molecular nitrogen
2-methyl-4-nitrophenol;molecular nitrogen (PubChem CID 166479227) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-methyl-4-nitrophenol;molecular nitrogen.
Molecular Properties
| Compound Name | 2-methyl-4-nitrophenol;molecular nitrogen |
| PubChem CID | 166479227 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-methyl-4-nitrophenol;molecular nitrogen |
| SMILES | Cc1cc([N+](=O)[O-])ccc1O.N#N |
| InChI | InChI=1S/C7H7NO3.N2/c1-5-4-6(8(10)11)2-3-7(5)9;1-2/h2-4,9H,1H3; |
| InChIKey | JLENCMUWGGJRKQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-nitrophenol;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-nitrophenol;molecular nitrogen?
The IUPAC name of 2-methyl-4-nitrophenol;molecular nitrogen (CID 166479227) is 2-methyl-4-nitrophenol;molecular nitrogen.
What is the SMILES notation for 2-methyl-4-nitrophenol;molecular nitrogen?
The canonical SMILES for 2-methyl-4-nitrophenol;molecular nitrogen is Cc1cc([N+](=O)[O-])ccc1O.N#N.
What is the InChIKey of 2-methyl-4-nitrophenol;molecular nitrogen?
The InChIKey is JLENCMUWGGJRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.N2/c1-5-4-6(8(10)11)2-3-7(5)9;1-2/h2-4,9H,1H3;.
What are the key properties of 2-methyl-4-nitrophenol;molecular nitrogen?
2-methyl-4-nitrophenol;molecular nitrogen has a molecular weight of 181.15 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-nitrophenol;molecular nitrogen is sourced from PubChem (CID 166479227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).