C26H19N5O10 — CID 132566625
1,8,15,22-tetramethyl-4,5,11,12,18-pentanitrohexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16(21),17,19-nonaene (PubChem CID 132566625) has the molecular formula C26H19N5O10 and a molecular weight of 561.46 g/mol. Its IUPAC name is 1,8,15,22-tetramethyl-4,5,11,12,18-pentanitrohexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16(21),17,19-nonaene.
| Compound Name | 1,8,15,22-tetramethyl-4,5,11,12,18-pentanitrohexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16(21),17,19-nonaene |
|---|---|
| PubChem CID | 132566625 |
| Molecular Formula | C26H19N5O10 |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 1,8,15,22-tetramethyl-4,5,11,12,18-pentanitrohexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16(21),17,19-nonaene |
| SMILES | CC12c3ccc([N+](=O)[O-])cc3C3(C)c4cc([N+](=O)[O-])c([N+](=O)[O-])cc4C(C)(c4cc([N+](=O)[O-])c([N+](=O)[O-])cc41)C23C |
| InChI | InChI=1S/C26H19N5O10/c1-23-13-6-5-12(27(32)33)7-14(13)24(2)17-10-21(30(38)39)22(31(40)41)11-18(17)25(3,26(23,24)4)16-9-20(29(36)37)19(28(34)35)8-15(16)23/h5-11H,1-4H3 |
| InChIKey | BLDCGBRZWWWGBZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 215.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|