C12H16N2O3 — CID 143412729
3,3-dimethyl-5-nitro-1H-indol-2-one;ethane (PubChem CID 143412729) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3,3-dimethyl-5-nitro-1H-indol-2-one;ethane.
| Compound Name | 3,3-dimethyl-5-nitro-1H-indol-2-one;ethane |
|---|---|
| PubChem CID | 143412729 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3,3-dimethyl-5-nitro-1H-indol-2-one;ethane |
| SMILES | CC.CC1(C)C(=O)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H10N2O3.C2H6/c1-10(2)7-5-6(12(14)15)3-4-8(7)11-9(10)13;1-2/h3-5H,1-2H3,(H,11,13);1-2H3 |
| InChIKey | WKSINFQMRKWNTN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|