C10H8N2O3S2 — CID 2966150
5'-nitrospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one (PubChem CID 2966150) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5'-nitrospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one.
| Compound Name | 5'-nitrospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 2966150 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 5'-nitrospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C12SCCS2 |
| InChI | InChI=1S/C10H8N2O3S2/c13-9-10(16-3-4-17-10)7-5-6(12(14)15)1-2-8(7)11-9/h1-2,5H,3-4H2,(H,11,13) |
| InChIKey | CZXFHLSBHJOKNR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|