C16H16N2O6 — CID 177464265
(1'S,3S,5'S)-1'-acetyl-5'-methyl-5-nitrospiro[1H-indole-3,7'-6,8-dioxabicyclo[3.2.1]octane]-2-one (PubChem CID 177464265) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is (1'S,3S,5'S)-1'-acetyl-5'-methyl-5-nitrospiro[1H-indole-3,7'-6,8-dioxabicyclo[3.2.1]octane]-2-one.
| Compound Name | (1'S,3S,5'S)-1'-acetyl-5'-methyl-5-nitrospiro[1H-indole-3,7'-6,8-dioxabicyclo[3.2.1]octane]-2-one |
|---|---|
| PubChem CID | 177464265 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (1'S,3S,5'S)-1'-acetyl-5'-methyl-5-nitrospiro[1H-indole-3,7'-6,8-dioxabicyclo[3.2.1]octane]-2-one |
| SMILES | CC(=O)[C@@]12CCC[C@@](C)(O1)O[C@]21C(=O)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H16N2O6/c1-9(19)15-7-3-6-14(2,23-15)24-16(15)11-8-10(18(21)22)4-5-12(11)17-13(16)20/h4-5,8H,3,6-7H2,1-2H3,(H,17,20)/t14-,15+,16+/m0/s1 |
| InChIKey | RZRUBCWBYSXTPQ-ARFHVFGLSA-N |
| XLogP | 2.02 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|