C16H8F4N4O6 — CID 139059513
3,3-difluoro-5-nitro-1H-indol-2-one (PubChem CID 139059513) has the molecular formula C16H8F4N4O6 and a molecular weight of 428.25 g/mol. Its IUPAC name is 3,3-difluoro-5-nitro-1H-indol-2-one.
| Compound Name | 3,3-difluoro-5-nitro-1H-indol-2-one |
|---|---|
| PubChem CID | 139059513 |
| Molecular Formula | C16H8F4N4O6 |
| Molecular Weight | 428.25 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 3,3-difluoro-5-nitro-1H-indol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1(F)F.O=C1Nc2ccc([N+](=O)[O-])cc2C1(F)F |
| InChI | InChI=1S/2C8H4F2N2O3/c2*9-8(10)5-3-4(12(14)15)1-2-6(5)11-7(8)13/h2*1-3H,(H,11,13) |
| InChIKey | PSDGQZWIFFGALL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|