C26H18ClN5O5 — CID 70681024
5-chloro-3,3-bis(2-methyl-5-nitro-1H-indol-3-yl)-1H-indol-2-one (PubChem CID 70681024) has the molecular formula C26H18ClN5O5 and a molecular weight of 515.91 g/mol. Its IUPAC name is 5-chloro-3,3-bis(2-methyl-5-nitro-1H-indol-3-yl)-1H-indol-2-one.
| Compound Name | 5-chloro-3,3-bis(2-methyl-5-nitro-1H-indol-3-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 70681024 |
| Molecular Formula | C26H18ClN5O5 |
| Molecular Weight | 515.91 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 5-chloro-3,3-bis(2-methyl-5-nitro-1H-indol-3-yl)-1H-indol-2-one |
| SMILES | Cc1[nH]c2ccc([N+](=O)[O-])cc2c1C1(c2c(C)[nH]c3ccc([N+](=O)[O-])cc23)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H18ClN5O5/c1-12-23(17-10-15(31(34)35)4-7-20(17)28-12)26(19-9-14(27)3-6-22(19)30-25(26)33)24-13(2)29-21-8-5-16(32(36)37)11-18(21)24/h3-11,28-29H,1-2H3,(H,30,33) |
| InChIKey | WHZINFSZFRIHLB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.91 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|