C17H9ClN4O2 — CID 14146970
16-chloro-5-nitro-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 14146970) has the molecular formula C17H9ClN4O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 16-chloro-5-nitro-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 16-chloro-5-nitro-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 14146970 |
| Molecular Formula | C17H9ClN4O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 16-chloro-5-nitro-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | O=[N+]([O-])c1ccc2[nH]c3cnc4c5cc(Cl)ccc5[nH]c4c3c2c1 |
| InChI | InChI=1S/C17H9ClN4O2/c18-8-1-3-13-11(5-8)16-17(21-13)15-10-6-9(22(23)24)2-4-12(10)20-14(15)7-19-16/h1-7,20-21H |
| InChIKey | MLLJSDZYVYBVBM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|