C17H10N4O4 — CID 73441786
6-nitro-1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole (PubChem CID 73441786) has the molecular formula C17H10N4O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 6-nitro-1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 6-nitro-1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 73441786 |
| Molecular Formula | C17H10N4O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 6-nitro-1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1ccc(-c2nccc3c2[nH]c2ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C17H10N4O4/c22-20(23)11-3-1-10(2-4-11)16-17-13(7-8-18-16)14-9-12(21(24)25)5-6-15(14)19-17/h1-9,19H |
| InChIKey | XOYUGSRNKGWGHA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|