C18H10N4O4 — CID 11653124
3,8-dinitro-11,12-dihydroindolo[2,3-a]carbazole (PubChem CID 11653124) has the molecular formula C18H10N4O4 and a molecular weight of 346.30 g/mol. Its IUPAC name is 3,8-dinitro-11,12-dihydroindolo[2,3-a]carbazole.
| Compound Name | 3,8-dinitro-11,12-dihydroindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 11653124 |
| Molecular Formula | C18H10N4O4 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3,8-dinitro-11,12-dihydroindolo[2,3-a]carbazole |
| SMILES | O=[N+]([O-])c1ccc2[nH]c3c(ccc4c5cc([N+](=O)[O-])ccc5[nH]c43)c2c1 |
| InChI | InChI=1S/C18H10N4O4/c23-21(24)9-1-5-15-13(7-9)11-3-4-12-14-8-10(22(25)26)2-6-16(14)20-18(12)17(11)19-15/h1-8,19-20H |
| InChIKey | HSESGNIXJULVBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|