C12H6BrN3O4 — CID 15066339
6-bromo-9-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione (PubChem CID 15066339) has the molecular formula C12H6BrN3O4 and a molecular weight of 336.10 g/mol. Its IUPAC name is 6-bromo-9-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione.
| Compound Name | 6-bromo-9-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 15066339 |
| Molecular Formula | C12H6BrN3O4 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 6-bromo-9-nitro-1,4-dihydrobenzo[f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(Br)c3ccc([N+](=O)[O-])cc3c2[nH]c1=O |
| InChI | InChI=1S/C12H6BrN3O4/c13-8-4-9-10(15-12(18)11(17)14-9)7-3-5(16(19)20)1-2-6(7)8/h1-4H,(H,14,17)(H,15,18) |
| InChIKey | CBBDRGOSQDTZTH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|