C8H5N3O4 — CID 3398113
7-nitro-1H-quinazoline-2,4-dione (PubChem CID 3398113) has the molecular formula C8H5N3O4 and a molecular weight of 207.15 g/mol. Its IUPAC name is 7-nitro-1H-quinazoline-2,4-dione.
| Compound Name | 7-nitro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3398113 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 7-nitro-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C8H5N3O4/c12-7-5-2-1-4(11(14)15)3-6(5)9-8(13)10-7/h1-3H,(H2,9,10,12,13) |
| InChIKey | FDAQHIHYBBEDQQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|