C12H10N2O5 — CID 54713985
4-hydroxy-7-nitro-3-prop-2-enoxy-1H-quinolin-2-one (PubChem CID 54713985) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 4-hydroxy-7-nitro-3-prop-2-enoxy-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-7-nitro-3-prop-2-enoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54713985 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-hydroxy-7-nitro-3-prop-2-enoxy-1H-quinolin-2-one |
| SMILES | C=CCOc1c(O)c2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C12H10N2O5/c1-2-5-19-11-10(15)8-4-3-7(14(17)18)6-9(8)13-12(11)16/h2-4,6H,1,5H2,(H2,13,15,16) |
| InChIKey | HAAMNNAGMBUYHV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|