C24H30N2O5 — CID 54004925
3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-7-nitro-1H-quinolin-2-one (PubChem CID 54004925) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-7-nitro-1H-quinolin-2-one.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-7-nitro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54004925 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-7-nitro-1H-quinolin-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1c(OCC=C(C)C)c2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C24H30N2O5/c1-16(2)7-6-8-18(5)12-14-31-23-22(30-13-11-17(3)4)20-10-9-19(26(28)29)15-21(20)25-24(23)27/h7,9-12,15H,6,8,13-14H2,1-5H3,(H,25,27) |
| InChIKey | KOEMVLQWYGGUSJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|