C25H36N2O3 — CID 23300175
3-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-(ethylamino)-1H-quinolin-2-one (PubChem CID 23300175) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 3-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-(ethylamino)-1H-quinolin-2-one.
| Compound Name | 3-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-(ethylamino)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 23300175 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 3-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-(ethylamino)-1H-quinolin-2-one |
| SMILES | CCCCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(NCC)cc2[nH]c1=O |
| InChI | InChI=1S/C25H36N2O3/c1-6-8-15-29-24-23(30-16-14-19(5)11-9-10-18(3)4)21-13-12-20(26-7-2)17-22(21)27-25(24)28/h10,12-14,17,26H,6-9,11,15-16H2,1-5H3,(H,27,28)/b19-14+ |
| InChIKey | YJLCKLTYVPTUBS-XMHGGMMESA-N |
| XLogP | 6.21 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|