C27H31NO4 — CID 139717739
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-4-phenylmethoxy-1H-quinolin-2-one (PubChem CID 139717739) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-4-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-4-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139717739 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-4-phenylmethoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2c(OCc3ccccc3)c(OC/C=C(\C)CCC=C(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C27H31NO4/c1-19(2)9-8-10-20(3)15-16-31-26-25(32-18-21-11-6-5-7-12-21)23-14-13-22(30-4)17-24(23)28-27(26)29/h5-7,9,11-15,17H,8,10,16,18H2,1-4H3,(H,28,29)/b20-15+ |
| InChIKey | VLEIYLVKLALKPD-HMMYKYKNSA-N |
| XLogP | 6.19 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|