C20H26N2O3 — CID 70251836
7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-1H-quinolin-2-one (PubChem CID 70251836) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-1H-quinolin-2-one.
| Compound Name | 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70251836 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-1H-quinolin-2-one |
| SMILES | COc1c(OC/C=C(\C)CCC=C(C)C)c(=O)[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C20H26N2O3/c1-13(2)6-5-7-14(3)10-11-25-19-18(24-4)16-9-8-15(21)12-17(16)22-20(19)23/h6,8-10,12H,5,7,11,21H2,1-4H3,(H,22,23)/b14-10+ |
| InChIKey | URRUVSOLBZGJMB-GXDHUFHOSA-N |
| XLogP | 4.19 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|