C22H30N2O3 — CID 54367409
7-amino-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-1H-quinolin-2-one (PubChem CID 54367409) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 7-amino-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-1H-quinolin-2-one.
| Compound Name | 7-amino-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54367409 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 7-amino-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-1H-quinolin-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1c(OC(C)C)c(=O)[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C22H30N2O3/c1-14(2)7-6-8-16(5)11-12-26-20-18-10-9-17(23)13-19(18)24-22(25)21(20)27-15(3)4/h7,9-11,13,15H,6,8,12,23H2,1-5H3,(H,24,25) |
| InChIKey | UQSOYFICRWWILC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|