C29H38N2O5 — CID 70252819
3,4-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-1H-quinolin-2-one (PubChem CID 70252819) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is 3,4-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-1H-quinolin-2-one.
| Compound Name | 3,4-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70252819 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 3,4-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-1H-quinolin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(OC/C=C(\C)CCC=C(C)C)c2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C29H38N2O5/c1-20(2)9-7-11-22(5)15-17-35-27-25-14-13-24(31(33)34)19-26(25)30-29(32)28(27)36-18-16-23(6)12-8-10-21(3)4/h9-10,13-16,19H,7-8,11-12,17-18H2,1-6H3,(H,30,32)/b22-15+,23-16+ |
| InChIKey | BZHFPJCJNXKTGB-QAOSGDJLSA-N |
| XLogP | 7.58 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|