C26H36N2O3 — CID 70251765
7-(dimethylamino)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(3-methylbut-2-enoxy)-1H-quinolin-2-one (PubChem CID 70251765) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 7-(dimethylamino)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(3-methylbut-2-enoxy)-1H-quinolin-2-one.
| Compound Name | 7-(dimethylamino)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(3-methylbut-2-enoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70251765 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 7-(dimethylamino)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(3-methylbut-2-enoxy)-1H-quinolin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(OCC=C(C)C)c2ccc(N(C)C)cc2[nH]c1=O |
| InChI | InChI=1S/C26H36N2O3/c1-18(2)9-8-10-20(5)14-16-31-25-24(30-15-13-19(3)4)22-12-11-21(28(6)7)17-23(22)27-26(25)29/h9,11-14,17H,8,10,15-16H2,1-7H3,(H,27,29)/b20-14+ |
| InChIKey | YXHNHXUFJXQARV-XSFVSMFZSA-N |
| XLogP | 6.01 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|