C27H40N2O3 — CID 54040035
4-(3,7-dimethylocta-2,6-dienoxy)-7-(ethylamino)-3-hexoxy-1H-quinolin-2-one (PubChem CID 54040035) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-7-(ethylamino)-3-hexoxy-1H-quinolin-2-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-7-(ethylamino)-3-hexoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54040035 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-7-(ethylamino)-3-hexoxy-1H-quinolin-2-one |
| SMILES | CCCCCCOc1c(OCC=C(C)CCC=C(C)C)c2ccc(NCC)cc2[nH]c1=O |
| InChI | InChI=1S/C27H40N2O3/c1-6-8-9-10-17-31-26-25(32-18-16-21(5)13-11-12-20(3)4)23-15-14-22(28-7-2)19-24(23)29-27(26)30/h12,14-16,19,28H,6-11,13,17-18H2,1-5H3,(H,29,30) |
| InChIKey | LLRCFNDTHWAHJH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|