C29H35NO4 — CID 139717823
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-phenylmethoxy-3-propan-2-yloxy-1H-quinolin-2-one (PubChem CID 139717823) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-phenylmethoxy-3-propan-2-yloxy-1H-quinolin-2-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-phenylmethoxy-3-propan-2-yloxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139717823 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-phenylmethoxy-3-propan-2-yloxy-1H-quinolin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(OC(C)C)c(=O)[nH]c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C29H35NO4/c1-20(2)10-9-11-22(5)16-17-32-27-25-15-14-24(33-19-23-12-7-6-8-13-23)18-26(25)30-29(31)28(27)34-21(3)4/h6-8,10,12-16,18,21H,9,11,17,19H2,1-5H3,(H,30,31)/b22-16+ |
| InChIKey | UKVVZVXKSDTRCB-CJLVFECKSA-N |
| XLogP | 6.97 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|