C22H15N5O6 — CID 90957903
3,4-bis(2-methyl-6-nitro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 90957903) has the molecular formula C22H15N5O6 and a molecular weight of 445.39 g/mol. Its IUPAC name is 3,4-bis(2-methyl-6-nitro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(2-methyl-6-nitro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 90957903 |
| Molecular Formula | C22H15N5O6 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3,4-bis(2-methyl-6-nitro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1[nH]c2cc([N+](=O)[O-])ccc2c1C1=C(c2c(C)[nH]c3cc([N+](=O)[O-])ccc23)C(=O)NC1=O |
| InChI | InChI=1S/C22H15N5O6/c1-9-17(13-5-3-11(26(30)31)7-15(13)23-9)19-20(22(29)25-21(19)28)18-10(2)24-16-8-12(27(32)33)4-6-14(16)18/h3-8,23-24H,1-2H3,(H,25,28,29) |
| InChIKey | LLZODCGHEONDQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|