C12H12N2O2 — CID 15621612
7-nitro-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 15621612) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 7-nitro-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 7-nitro-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 15621612 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 7-nitro-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | O=[N+]([O-])c1ccc2c3c([nH]c2c1)CCCC3 |
| InChI | InChI=1S/C12H12N2O2/c15-14(16)8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h5-7,13H,1-4H2 |
| InChIKey | XLQGMWWMXBHMQX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|