C21H18ClN3O5 — CID 42967592
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 42967592) has the molecular formula C21H18ClN3O5 and a molecular weight of 427.84 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 42967592 |
| Molecular Formula | C21H18ClN3O5 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H18ClN3O5/c22-16-7-6-13(25(28)29)10-19(16)24-20(26)11-30-21(27)12-5-8-18-15(9-12)14-3-1-2-4-17(14)23-18/h5-10,23H,1-4,11H2,(H,24,26) |
| InChIKey | SEHXUHFGJQDTHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|