C12H10N4O3 — CID 82220684
4-(2-methyl-6-nitro-1H-indol-3-yl)-1,3-oxazol-2-amine (PubChem CID 82220684) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 4-(2-methyl-6-nitro-1H-indol-3-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(2-methyl-6-nitro-1H-indol-3-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 82220684 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-(2-methyl-6-nitro-1H-indol-3-yl)-1,3-oxazol-2-amine |
| SMILES | Cc1[nH]c2cc([N+](=O)[O-])ccc2c1-c1coc(N)n1 |
| InChI | InChI=1S/C12H10N4O3/c1-6-11(10-5-19-12(13)15-10)8-3-2-7(16(17)18)4-9(8)14-6/h2-5,14H,1H3,(H2,13,15) |
| InChIKey | GHHOOSGQBPIVKX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|