C14H10N2O2 — CID 118641028
7-phenyl-1H-quinazoline-2,4-dione (PubChem CID 118641028) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 7-phenyl-1H-quinazoline-2,4-dione.
| Compound Name | 7-phenyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 118641028 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 7-phenyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2ccc(-c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C14H10N2O2/c17-13-11-7-6-10(9-4-2-1-3-5-9)8-12(11)15-14(18)16-13/h1-8H,(H2,15,16,17,18) |
| InChIKey | HAOJWCGUAIHQLD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |