C10H7BrN2O4 — CID 19604286
bromomethyl 2,4-dioxo-1H-quinazoline-7-carboxylate (PubChem CID 19604286) has the molecular formula C10H7BrN2O4 and a molecular weight of 299.08 g/mol. Its IUPAC name is bromomethyl 2,4-dioxo-1H-quinazoline-7-carboxylate.
| Compound Name | bromomethyl 2,4-dioxo-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 19604286 |
| Molecular Formula | C10H7BrN2O4 |
| Molecular Weight | 299.08 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | bromomethyl 2,4-dioxo-1H-quinazoline-7-carboxylate |
| SMILES | O=C(OCBr)c1ccc2c(=O)[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H7BrN2O4/c11-4-17-9(15)5-1-2-6-7(3-5)12-10(16)13-8(6)14/h1-3H,4H2,(H2,12,13,14,16) |
| InChIKey | KHKAXWAZZHGORI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.08 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|