C11H8Cl2N2O4 — CID 19604416
1,2-dichloroethyl 2,4-dioxo-1H-quinazoline-7-carboxylate (PubChem CID 19604416) has the molecular formula C11H8Cl2N2O4 and a molecular weight of 303.10 g/mol. Its IUPAC name is 1,2-dichloroethyl 2,4-dioxo-1H-quinazoline-7-carboxylate.
| Compound Name | 1,2-dichloroethyl 2,4-dioxo-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 19604416 |
| Molecular Formula | C11H8Cl2N2O4 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 1,2-dichloroethyl 2,4-dioxo-1H-quinazoline-7-carboxylate |
| SMILES | O=C(OC(Cl)CCl)c1ccc2c(=O)[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H8Cl2N2O4/c12-4-8(13)19-10(17)5-1-2-6-7(3-5)14-11(18)15-9(6)16/h1-3,8H,4H2,(H2,14,15,16,18) |
| InChIKey | ONRAJZHFOKUUSH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|