C10H6Cl2N2O4 — CID 19604358
dichloromethyl 2,4-dioxo-1H-quinazoline-6-carboxylate (PubChem CID 19604358) has the molecular formula C10H6Cl2N2O4 and a molecular weight of 289.07 g/mol. Its IUPAC name is dichloromethyl 2,4-dioxo-1H-quinazoline-6-carboxylate.
| Compound Name | dichloromethyl 2,4-dioxo-1H-quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 19604358 |
| Molecular Formula | C10H6Cl2N2O4 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | dichloromethyl 2,4-dioxo-1H-quinazoline-6-carboxylate |
| SMILES | O=C(OC(Cl)Cl)c1ccc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H6Cl2N2O4/c11-9(12)18-8(16)4-1-2-6-5(3-4)7(15)14-10(17)13-6/h1-3,9H,(H2,13,14,15,17) |
| InChIKey | ISASEWVOHBPKCP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|