acetic acid;1H-quinazoline-2,4-dione

C10H10N2O4 — CID 67165558

IUPACacetic acid;1H-quinazoline-2,4-dione
SMILESCC(=O)O.O=c1[nH]c(=O)c2ccccc2[nH]1
InChIInChI=1S/C8H6N2O2.C2H4O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7;1-2(3)4/h1-4H,(H2,9,10,11,12);1H3,(H,3,4)
InChIKeyAOUDKENFHQXBSB-UHFFFAOYSA-N
MW222.20 g/mol
LogP0.31
Rot. Bonds

About acetic acid;1H-quinazoline-2,4-dione

acetic acid;1H-quinazoline-2,4-dione (PubChem CID 67165558) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is acetic acid;1H-quinazoline-2,4-dione.

Molecular Properties

Compound Nameacetic acid;1H-quinazoline-2,4-dione
PubChem CID67165558
Molecular FormulaC10H10N2O4
Molecular Weight222.20 g/mol
Exact Mass222.06
IUPAC Nameacetic acid;1H-quinazoline-2,4-dione
SMILESCC(=O)O.O=c1[nH]c(=O)c2ccccc2[nH]1
InChIInChI=1S/C8H6N2O2.C2H4O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7;1-2(3)4/h1-4H,(H2,9,10,11,12);1H3,(H,3,4)
InChIKeyAOUDKENFHQXBSB-UHFFFAOYSA-N
XLogP0.31
TPSA103.02 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.20
LogP ≤ 50.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze acetic acid;1H-quinazoline-2,4-dione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1H-quinazoline-2,4-dione?
The IUPAC name of acetic acid;1H-quinazoline-2,4-dione (CID 67165558) is acetic acid;1H-quinazoline-2,4-dione.
What is the SMILES notation for acetic acid;1H-quinazoline-2,4-dione?
The canonical SMILES for acetic acid;1H-quinazoline-2,4-dione is CC(=O)O.O=c1[nH]c(=O)c2ccccc2[nH]1.
What is the InChIKey of acetic acid;1H-quinazoline-2,4-dione?
The InChIKey is AOUDKENFHQXBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C2H4O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7;1-2(3)4/h1-4H,(H2,9,10,11,12);1H3,(H,3,4).
What are the key properties of acetic acid;1H-quinazoline-2,4-dione?
acetic acid;1H-quinazoline-2,4-dione has a molecular weight of 222.20 g/mol, XLogP of 0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1H-quinazoline-2,4-dione is sourced from PubChem (CID 67165558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).