About 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide
1,3-dihydrobenzimidazol-2-one;3-oxobutanamide (PubChem CID 159803991) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide.
Molecular Properties
| Compound Name | 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide |
| PubChem CID | 159803991 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide |
| SMILES | CC(=O)CC(N)=O.O=c1[nH]c2ccccc2[nH]1 |
| InChI | InChI=1S/C7H6N2O.C4H7NO2/c10-7-8-5-3-1-2-4-6(5)9-7;1-3(6)2-4(5)7/h1-4H,(H2,8,9,10);2H2,1H3,(H2,5,7) |
| InChIKey | NKDRHENZFNJTAR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide?
The IUPAC name of 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide (CID 159803991) is 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide.
What is the SMILES notation for 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide?
The canonical SMILES for 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide is CC(=O)CC(N)=O.O=c1[nH]c2ccccc2[nH]1.
What is the InChIKey of 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide?
The InChIKey is NKDRHENZFNJTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.C4H7NO2/c10-7-8-5-3-1-2-4-6(5)9-7;1-3(6)2-4(5)7/h1-4H,(H2,8,9,10);2H2,1H3,(H2,5,7).
What are the key properties of 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide?
1,3-dihydrobenzimidazol-2-one;3-oxobutanamide has a molecular weight of 235.24 g/mol, XLogP of 0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydrobenzimidazol-2-one;3-oxobutanamide is sourced from PubChem (CID 159803991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).