C7H6N2OZn — CID 174871541
1,3-dihydrobenzimidazol-2-one;zinc (PubChem CID 174871541) has the molecular formula C7H6N2OZn and a molecular weight of 199.53 g/mol. Its IUPAC name is 1,3-dihydrobenzimidazol-2-one;zinc.
| Compound Name | 1,3-dihydrobenzimidazol-2-one;zinc |
|---|---|
| PubChem CID | 174871541 |
| Molecular Formula | C7H6N2OZn |
| Molecular Weight | 199.53 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 1,3-dihydrobenzimidazol-2-one;zinc |
| SMILES | O=c1[nH]c2ccccc2[nH]1.[Zn] |
| InChI | InChI=1S/C7H6N2O.Zn/c10-7-8-5-3-1-2-4-6(5)9-7;/h1-4H,(H2,8,9,10); |
| InChIKey | CKAKFCOESNWOKA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|