C9H6N2O3 — CID 12917041
1,5-dihydro-1,5-benzodiazepine-2,3,4-trione (PubChem CID 12917041) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 1,5-dihydro-1,5-benzodiazepine-2,3,4-trione.
| Compound Name | 1,5-dihydro-1,5-benzodiazepine-2,3,4-trione |
|---|---|
| PubChem CID | 12917041 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1,5-dihydro-1,5-benzodiazepine-2,3,4-trione |
| SMILES | O=c1[nH]c2ccccc2[nH]c(=O)c1=O |
| InChI | InChI=1S/C9H6N2O3/c12-7-8(13)10-5-3-1-2-4-6(5)11-9(7)14/h1-4H,(H2,10,11,12,13,14) |
| InChIKey | LPTJUMCCSJMSHZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|