C9H5N3O — CID 136619278
4H-diazeto[3,4-c]quinolin-3-one (PubChem CID 136619278) has the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. Its IUPAC name is 4H-diazeto[3,4-c]quinolin-3-one.
| Compound Name | 4H-diazeto[3,4-c]quinolin-3-one |
|---|---|
| PubChem CID | 136619278 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 4H-diazeto[3,4-c]quinolin-3-one |
| SMILES | O=c1[nH]c2ccccc2c2c1N=N2 |
| InChI | InChI=1S/C9H5N3O/c13-9-8-7(11-12-8)5-3-1-2-4-6(5)10-9/h1-4H,(H,10,13) |
| InChIKey | RXYSHNXLUIQLES-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |